C20H19F2N3O2 — CID 151746235
(4,4-difluoropiperidin-1-yl)-[3-(8-hydroxy-1,2-dihydroquinazolin-6-yl)phenyl]methanone (PubChem CID 151746235) has the molecular formula C20H19F2N3O2 and a molecular weight of 371.39 g/mol. Its IUPAC name is (4,4-difluoropiperidin-1-yl)-[3-(8-hydroxy-1,2-dihydroquinazolin-6-yl)phenyl]methanone.
| Compound Name | (4,4-difluoropiperidin-1-yl)-[3-(8-hydroxy-1,2-dihydroquinazolin-6-yl)phenyl]methanone |
|---|---|
| PubChem CID | 151746235 |
| Molecular Formula | C20H19F2N3O2 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | (4,4-difluoropiperidin-1-yl)-[3-(8-hydroxy-1,2-dihydroquinazolin-6-yl)phenyl]methanone |
| SMILES | O=C(c1cccc(-c2cc(O)c3c(c2)C=NCN3)c1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C20H19F2N3O2/c21-20(22)4-6-25(7-5-20)19(27)14-3-1-2-13(8-14)15-9-16-11-23-12-24-18(16)17(26)10-15/h1-3,8-11,24,26H,4-7,12H2 |
| InChIKey | OJSVJCGBAHSPAY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|