C22H36O3 — CID 151766433
1-prop-2-enyl-3-(1,1,1-trimethoxydecan-2-yl)benzene (PubChem CID 151766433) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is 1-prop-2-enyl-3-(1,1,1-trimethoxydecan-2-yl)benzene.
| Compound Name | 1-prop-2-enyl-3-(1,1,1-trimethoxydecan-2-yl)benzene |
|---|---|
| PubChem CID | 151766433 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | 1-prop-2-enyl-3-(1,1,1-trimethoxydecan-2-yl)benzene |
| SMILES | C=CCc1cccc(C(CCCCCCCC)C(OC)(OC)OC)c1 |
| InChI | InChI=1S/C22H36O3/c1-6-8-9-10-11-12-17-21(22(23-3,24-4)25-5)20-16-13-15-19(18-20)14-7-2/h7,13,15-16,18,21H,2,6,8-12,14,17H2,1,3-5H3 |
| InChIKey | RRRFVAWRIJZMIT-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|