C11H12N4O2 — CID 15178777
5,6-dimethyl-2-(4-nitrophenyl)-3H-1,2,4-triazine (PubChem CID 15178777) has the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. Its IUPAC name is 5,6-dimethyl-2-(4-nitrophenyl)-3H-1,2,4-triazine.
| Compound Name | 5,6-dimethyl-2-(4-nitrophenyl)-3H-1,2,4-triazine |
|---|---|
| PubChem CID | 15178777 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 5,6-dimethyl-2-(4-nitrophenyl)-3H-1,2,4-triazine |
| SMILES | CC1=NCN(c2ccc([N+](=O)[O-])cc2)N=C1C |
| InChI | InChI=1S/C11H12N4O2/c1-8-9(2)13-14(7-12-8)10-3-5-11(6-4-10)15(16)17/h3-6H,7H2,1-2H3 |
| InChIKey | MWOVOKNWJIKTHR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 71.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|