C14H17NO6S — CID 151796278
2-ethyl-3-methyl-4-(6-sulfo-1,3-benzoxazol-2-yl)butanoic acid (PubChem CID 151796278) has the molecular formula C14H17NO6S and a molecular weight of 327.36 g/mol. Its IUPAC name is 2-ethyl-3-methyl-4-(6-sulfo-1,3-benzoxazol-2-yl)butanoic acid.
| Compound Name | 2-ethyl-3-methyl-4-(6-sulfo-1,3-benzoxazol-2-yl)butanoic acid |
|---|---|
| PubChem CID | 151796278 |
| Molecular Formula | C14H17NO6S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 2-ethyl-3-methyl-4-(6-sulfo-1,3-benzoxazol-2-yl)butanoic acid |
| SMILES | CCC(C(=O)O)C(C)Cc1nc2ccc(S(=O)(=O)O)cc2o1 |
| InChI | InChI=1S/C14H17NO6S/c1-3-10(14(16)17)8(2)6-13-15-11-5-4-9(22(18,19)20)7-12(11)21-13/h4-5,7-8,10H,3,6H2,1-2H3,(H,16,17)(H,18,19,20) |
| InChIKey | RXQUXOAMDBOJMK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|