C24H21BrF4O3 — CID 151805694
1-bromo-4-[1-(difluoromethoxy)-1,3-difluoro-2-methyl-1-[(3-phenoxyphenyl)methoxy]propan-2-yl]benzene (PubChem CID 151805694) has the molecular formula C24H21BrF4O3 and a molecular weight of 513.33 g/mol. Its IUPAC name is 1-bromo-4-[1-(difluoromethoxy)-1,3-difluoro-2-methyl-1-[(3-phenoxyphenyl)methoxy]propan-2-yl]benzene.
| Compound Name | 1-bromo-4-[1-(difluoromethoxy)-1,3-difluoro-2-methyl-1-[(3-phenoxyphenyl)methoxy]propan-2-yl]benzene |
|---|---|
| PubChem CID | 151805694 |
| Molecular Formula | C24H21BrF4O3 |
| Molecular Weight | 513.33 g/mol |
| Exact Mass | 512.06 |
| IUPAC Name | 1-bromo-4-[1-(difluoromethoxy)-1,3-difluoro-2-methyl-1-[(3-phenoxyphenyl)methoxy]propan-2-yl]benzene |
| SMILES | CC(CF)(c1ccc(Br)cc1)C(F)(OCc1cccc(Oc2ccccc2)c1)OC(F)F |
| InChI | InChI=1S/C24H21BrF4O3/c1-23(16-26,18-10-12-19(25)13-11-18)24(29,32-22(27)28)30-15-17-6-5-9-21(14-17)31-20-7-3-2-4-8-20/h2-14,22H,15-16H2,1H3 |
| InChIKey | RZOCIIZNRLTYES-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.33 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|