C17H25FN2O5S2 — CID 151807736
tert-butyl 4-[(2-fluoro-4-sulfamoylphenyl)sulfinylmethyl]piperidine-1-carboxylate (PubChem CID 151807736) has the molecular formula C17H25FN2O5S2 and a molecular weight of 420.53 g/mol. Its IUPAC name is tert-butyl 4-[(2-fluoro-4-sulfamoylphenyl)sulfinylmethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2-fluoro-4-sulfamoylphenyl)sulfinylmethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 151807736 |
| Molecular Formula | C17H25FN2O5S2 |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | tert-butyl 4-[(2-fluoro-4-sulfamoylphenyl)sulfinylmethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CS(=O)c2ccc(S(N)(=O)=O)cc2F)CC1 |
| InChI | InChI=1S/C17H25FN2O5S2/c1-17(2,3)25-16(21)20-8-6-12(7-9-20)11-26(22)15-5-4-13(10-14(15)18)27(19,23)24/h4-5,10,12H,6-9,11H2,1-3H3,(H2,19,23,24) |
| InChIKey | RZYROGCRMOPHKG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |