C18H34O2 — CID 151819019
7,8-dimethyl-7-propyltridec-5-yne-4,4-diol (PubChem CID 151819019) has the molecular formula C18H34O2 and a molecular weight of 282.47 g/mol. Its IUPAC name is 7,8-dimethyl-7-propyltridec-5-yne-4,4-diol.
| Compound Name | 7,8-dimethyl-7-propyltridec-5-yne-4,4-diol |
|---|---|
| PubChem CID | 151819019 |
| Molecular Formula | C18H34O2 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.26 |
| IUPAC Name | 7,8-dimethyl-7-propyltridec-5-yne-4,4-diol |
| SMILES | CCCCCC(C)C(C)(C#CC(O)(O)CCC)CCC |
| InChI | InChI=1S/C18H34O2/c1-6-9-10-11-16(4)17(5,12-7-2)14-15-18(19,20)13-8-3/h16,19-20H,6-13H2,1-5H3 |
| InChIKey | SCFRGOCZYKGTCU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|