C16H34O2 — CID 139843549
2,5,5,8-tetramethyl-6-propan-2-ylnonane-4,4-diol (PubChem CID 139843549) has the molecular formula C16H34O2 and a molecular weight of 258.45 g/mol. Its IUPAC name is 2,5,5,8-tetramethyl-6-propan-2-ylnonane-4,4-diol.
| Compound Name | 2,5,5,8-tetramethyl-6-propan-2-ylnonane-4,4-diol |
|---|---|
| PubChem CID | 139843549 |
| Molecular Formula | C16H34O2 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.26 |
| IUPAC Name | 2,5,5,8-tetramethyl-6-propan-2-ylnonane-4,4-diol |
| SMILES | CC(C)CC(C(C)C)C(C)(C)C(O)(O)CC(C)C |
| InChI | InChI=1S/C16H34O2/c1-11(2)9-14(13(5)6)15(7,8)16(17,18)10-12(3)4/h11-14,17-18H,9-10H2,1-8H3 |
| InChIKey | UUBIXCZSMOOQRX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|