C23H28F4N4O4S — CID 151819137
2-[2-(butylamino)-6-(trifluoromethyl)-3-pyridinyl]-N-[1-[3-fluoro-4-(methanesulfonamido)-5-methoxyphenyl]ethyl]prop-2-enamide (PubChem CID 151819137) has the molecular formula C23H28F4N4O4S and a molecular weight of 532.56 g/mol. Its IUPAC name is 2-[2-(butylamino)-6-(trifluoromethyl)-3-pyridinyl]-N-[1-[3-fluoro-4-(methanesulfonamido)-5-methoxyphenyl]ethyl]prop-2-enamide.
| Compound Name | 2-[2-(butylamino)-6-(trifluoromethyl)-3-pyridinyl]-N-[1-[3-fluoro-4-(methanesulfonamido)-5-methoxyphenyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 151819137 |
| Molecular Formula | C23H28F4N4O4S |
| Molecular Weight | 532.56 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | 2-[2-(butylamino)-6-(trifluoromethyl)-3-pyridinyl]-N-[1-[3-fluoro-4-(methanesulfonamido)-5-methoxyphenyl]ethyl]prop-2-enamide |
| SMILES | C=C(C(=O)NC(C)c1cc(F)c(NS(C)(=O)=O)c(OC)c1)c1ccc(C(F)(F)F)nc1NCCCC |
| InChI | InChI=1S/C23H28F4N4O4S/c1-6-7-10-28-21-16(8-9-19(30-21)23(25,26)27)13(2)22(32)29-14(3)15-11-17(24)20(18(12-15)35-4)31-36(5,33)34/h8-9,11-12,14,31H,2,6-7,10H2,1,3-5H3,(H,28,30)(H,29,32) |
| InChIKey | SCGIMDZITBTHPQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|