C23H25F3N4O3S — CID 150893519
2-[2-(butylamino)-6-(trifluoromethyl)-3-pyridinyl]-N-[[3-ethynyl-4-(methanesulfonamido)phenyl]methyl]prop-2-enamide (PubChem CID 150893519) has the molecular formula C23H25F3N4O3S and a molecular weight of 494.54 g/mol. Its IUPAC name is 2-[2-(butylamino)-6-(trifluoromethyl)-3-pyridinyl]-N-[[3-ethynyl-4-(methanesulfonamido)phenyl]methyl]prop-2-enamide.
| Compound Name | 2-[2-(butylamino)-6-(trifluoromethyl)-3-pyridinyl]-N-[[3-ethynyl-4-(methanesulfonamido)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 150893519 |
| Molecular Formula | C23H25F3N4O3S |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 2-[2-(butylamino)-6-(trifluoromethyl)-3-pyridinyl]-N-[[3-ethynyl-4-(methanesulfonamido)phenyl]methyl]prop-2-enamide |
| SMILES | C#Cc1cc(CNC(=O)C(=C)c2ccc(C(F)(F)F)nc2NCCCC)ccc1NS(C)(=O)=O |
| InChI | InChI=1S/C23H25F3N4O3S/c1-5-7-12-27-21-18(9-11-20(29-21)23(24,25)26)15(3)22(31)28-14-16-8-10-19(17(6-2)13-16)30-34(4,32)33/h2,8-11,13,30H,3,5,7,12,14H2,1,4H3,(H,27,29)(H,28,31) |
| InChIKey | KYMXZYCESAEBSF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|