amino N-carbamothioylcarbamate

C2H5N3O2S — CID 151836432

IUPACamino N-carbamothioylcarbamate
SMILESNOC(=O)NC(N)=S
InChIInChI=1S/C2H5N3O2S/c3-1(8)5-2(6)7-4/h4H2,(H3,3,5,6,8)
InChIKeySFTFQCBUDGXWLV-UHFFFAOYSA-N
MW135.15 g/mol
LogP-1.17
Rot. Bonds

About amino N-carbamothioylcarbamate

amino N-carbamothioylcarbamate (PubChem CID 151836432) has the molecular formula C2H5N3O2S and a molecular weight of 135.15 g/mol. Its IUPAC name is amino N-carbamothioylcarbamate.

Molecular Properties

Compound Nameamino N-carbamothioylcarbamate
PubChem CID151836432
Molecular FormulaC2H5N3O2S
Molecular Weight135.15 g/mol
Exact Mass135.01
IUPAC Nameamino N-carbamothioylcarbamate
SMILESNOC(=O)NC(N)=S
InChIInChI=1S/C2H5N3O2S/c3-1(8)5-2(6)7-4/h4H2,(H3,3,5,6,8)
InChIKeySFTFQCBUDGXWLV-UHFFFAOYSA-N
XLogP-1.17
TPSA90.37 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500135.15
LogP ≤ 5-1.17
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}

Analyze amino N-carbamothioylcarbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of amino N-carbamothioylcarbamate?
The IUPAC name of amino N-carbamothioylcarbamate (CID 151836432) is amino N-carbamothioylcarbamate.
What is the SMILES notation for amino N-carbamothioylcarbamate?
The canonical SMILES for amino N-carbamothioylcarbamate is NOC(=O)NC(N)=S.
What is the InChIKey of amino N-carbamothioylcarbamate?
The InChIKey is SFTFQCBUDGXWLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5N3O2S/c3-1(8)5-2(6)7-4/h4H2,(H3,3,5,6,8).
What are the key properties of amino N-carbamothioylcarbamate?
amino N-carbamothioylcarbamate has a molecular weight of 135.15 g/mol, XLogP of -1.17, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for amino N-carbamothioylcarbamate is sourced from PubChem (CID 151836432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).