About O-amino N-carbamoylcarbamothioate
O-amino N-carbamoylcarbamothioate (PubChem CID 54398285) has the molecular formula C2H5N3O2S
and a molecular weight of 135.15 g/mol. Its IUPAC name is O-amino N-carbamoylcarbamothioate.
Molecular Properties
| Compound Name | O-amino N-carbamoylcarbamothioate |
| PubChem CID | 54398285 |
| Molecular Formula | C2H5N3O2S |
| Molecular Weight | 135.15 g/mol |
| Exact Mass | 135.01 |
| IUPAC Name | O-amino N-carbamoylcarbamothioate |
| SMILES | NOC(=S)NC(N)=O |
| InChI | InChI=1S/C2H5N3O2S/c3-1(6)5-2(8)7-4/h4H2,(H3,3,5,6,8) |
| InChIKey | VLOWTOKGFDVYGJ-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.15 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-amino N-carbamoylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-amino N-carbamoylcarbamothioate?
The IUPAC name of O-amino N-carbamoylcarbamothioate (CID 54398285) is O-amino N-carbamoylcarbamothioate.
What is the SMILES notation for O-amino N-carbamoylcarbamothioate?
The canonical SMILES for O-amino N-carbamoylcarbamothioate is NOC(=S)NC(N)=O.
What is the InChIKey of O-amino N-carbamoylcarbamothioate?
The InChIKey is VLOWTOKGFDVYGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5N3O2S/c3-1(6)5-2(8)7-4/h4H2,(H3,3,5,6,8).
What are the key properties of O-amino N-carbamoylcarbamothioate?
O-amino N-carbamoylcarbamothioate has a molecular weight of 135.15 g/mol, XLogP of -1.17, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-amino N-carbamoylcarbamothioate is sourced from PubChem (CID 54398285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).