C8H8N2O2Si — CID 151843827
3-N-silylidenebenzene-1,3-dicarboxamide (PubChem CID 151843827) has the molecular formula C8H8N2O2Si and a molecular weight of 192.25 g/mol. Its IUPAC name is 3-N-silylidenebenzene-1,3-dicarboxamide.
| Compound Name | 3-N-silylidenebenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 151843827 |
| Molecular Formula | C8H8N2O2Si |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 3-N-silylidenebenzene-1,3-dicarboxamide |
| SMILES | NC(=O)c1cccc(C(=O)N=[SiH2])c1 |
| InChI | InChI=1S/C8H8N2O2Si/c9-7(11)5-2-1-3-6(4-5)8(12)10-13/h1-4H,13H2,(H2,9,11) |
| InChIKey | SHFOTEHXDYRXTA-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|