C34H34N2O6 — CID 15186678
N-[4-[2-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]ethoxy]phenyl]-9,10-dioxo-4a,9a-dihydroanthracene-1-carboxamide (PubChem CID 15186678) has the molecular formula C34H34N2O6 and a molecular weight of 566.65 g/mol. Its IUPAC name is N-[4-[2-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]ethoxy]phenyl]-9,10-dioxo-4a,9a-dihydroanthracene-1-carboxamide.
| Compound Name | N-[4-[2-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]ethoxy]phenyl]-9,10-dioxo-4a,9a-dihydroanthracene-1-carboxamide |
|---|---|
| PubChem CID | 15186678 |
| Molecular Formula | C34H34N2O6 |
| Molecular Weight | 566.65 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | N-[4-[2-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]ethoxy]phenyl]-9,10-dioxo-4a,9a-dihydroanthracene-1-carboxamide |
| SMILES | COc1ccc(CCN(C)CCOc2ccc(NC(=O)C3=CC=CC4C(=O)c5ccccc5C(=O)C34)cc2)cc1OC |
| InChI | InChI=1S/C34H34N2O6/c1-36(18-17-22-11-16-29(40-2)30(21-22)41-3)19-20-42-24-14-12-23(13-15-24)35-34(39)28-10-6-9-27-31(28)33(38)26-8-5-4-7-25(26)32(27)37/h4-16,21,27,31H,17-20H2,1-3H3,(H,35,39) |
| InChIKey | KHYXZBSDNOVTQI-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.65 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|