About dimethylaminomethanone;zinc
dimethylaminomethanone;zinc (PubChem CID 151869749) has the molecular formula C3H6NOZn-
and a molecular weight of 137.48 g/mol. Its IUPAC name is dimethylaminomethanone;zinc.
Molecular Properties
| Compound Name | dimethylaminomethanone;zinc |
| PubChem CID | 151869749 |
| Molecular Formula | C3H6NOZn- |
| Molecular Weight | 137.48 g/mol |
| Exact Mass | 135.97 |
| IUPAC Name | dimethylaminomethanone;zinc |
| SMILES | CN(C)[C-]=O.[Zn] |
| InChI | InChI=1S/C3H6NO.Zn/c1-4(2)3-5;/h1-2H3;/q-1; |
| InChIKey | PXEMDLLGQUNDLH-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.48 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethylaminomethanone;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylaminomethanone;zinc?
The IUPAC name of dimethylaminomethanone;zinc (CID 151869749) is dimethylaminomethanone;zinc.
What is the SMILES notation for dimethylaminomethanone;zinc?
The canonical SMILES for dimethylaminomethanone;zinc is CN(C)[C-]=O.[Zn].
What is the InChIKey of dimethylaminomethanone;zinc?
The InChIKey is PXEMDLLGQUNDLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6NO.Zn/c1-4(2)3-5;/h1-2H3;/q-1;.
What are the key properties of dimethylaminomethanone;zinc?
dimethylaminomethanone;zinc has a molecular weight of 137.48 g/mol, XLogP of -0.39, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylaminomethanone;zinc is sourced from PubChem (CID 151869749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).