C15H25N3O3 — CID 151877376
N-(2,5-dioxopyrrol-1-yl)undecanehydrazide (PubChem CID 151877376) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is N-(2,5-dioxopyrrol-1-yl)undecanehydrazide.
| Compound Name | N-(2,5-dioxopyrrol-1-yl)undecanehydrazide |
|---|---|
| PubChem CID | 151877376 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | N-(2,5-dioxopyrrol-1-yl)undecanehydrazide |
| SMILES | CCCCCCCCCCC(=O)N(N)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C15H25N3O3/c1-2-3-4-5-6-7-8-9-10-15(21)18(16)17-13(19)11-12-14(17)20/h11-12H,2-10,16H2,1H3 |
| InChIKey | SNYTWLJRHMQRJF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|