C14H20N6 — CID 15189470
(2S,3S,15R,16R)-1,4,8,11-tetrazatetracyclo[6.6.2.04,16.011,15]hexadecane-2,3-dicarbonitrile (PubChem CID 15189470) has the molecular formula C14H20N6 and a molecular weight of 272.36 g/mol. Its IUPAC name is (2S,3S,15R,16R)-1,4,8,11-tetrazatetracyclo[6.6.2.04,16.011,15]hexadecane-2,3-dicarbonitrile.
| Compound Name | (2S,3S,15R,16R)-1,4,8,11-tetrazatetracyclo[6.6.2.04,16.011,15]hexadecane-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 15189470 |
| Molecular Formula | C14H20N6 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | (2S,3S,15R,16R)-1,4,8,11-tetrazatetracyclo[6.6.2.04,16.011,15]hexadecane-2,3-dicarbonitrile |
| SMILES | N#C[C@@H]1[C@@H](C#N)N2CCCN3CCN4CCCN1[C@@H]4[C@H]32 |
| InChI | InChI=1S/C14H20N6/c15-9-11-12(10-16)20-6-2-4-18-8-7-17-3-1-5-19(11)13(17)14(18)20/h11-14H,1-8H2/t11-,12-,13-,14-/m1/s1 |
| InChIKey | JTYRPXHUWBGCOL-AAVRWANBSA-N |
| XLogP | -0.53 |
| TPSA | 60.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |