C8H14N2 — CID 56972747
1,3-dimethylpiperidine-2-carbonitrile (PubChem CID 56972747) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 1,3-dimethylpiperidine-2-carbonitrile.
| Compound Name | 1,3-dimethylpiperidine-2-carbonitrile |
|---|---|
| PubChem CID | 56972747 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 1,3-dimethylpiperidine-2-carbonitrile |
| SMILES | CC1CCCN(C)C1C#N |
| InChI | InChI=1S/C8H14N2/c1-7-4-3-5-10(2)8(7)6-9/h7-8H,3-5H2,1-2H3 |
| InChIKey | KPOSRUGEROSYFR-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |