About 1,5,9,12-tetrazatetracyclo[7.6.2.05,16.012,17]heptadecane
1,5,9,12-tetrazatetracyclo[7.6.2.05,16.012,17]heptadecane (PubChem CID 54122759) has the molecular formula C13H24N4
and a molecular weight of 236.36 g/mol. Its IUPAC name is 1,5,9,12-tetrazatetracyclo[7.6.2.05,16.012,17]heptadecane.
Analyze 1,5,9,12-tetrazatetracyclo[7.6.2.05,16.012,17]heptadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5,9,12-tetrazatetracyclo[7.6.2.05,16.012,17]heptadecane?
The IUPAC name of 1,5,9,12-tetrazatetracyclo[7.6.2.05,16.012,17]heptadecane (CID 54122759) is 1,5,9,12-tetrazatetracyclo[7.6.2.05,16.012,17]heptadecane.
What is the SMILES notation for 1,5,9,12-tetrazatetracyclo[7.6.2.05,16.012,17]heptadecane?
The canonical SMILES for 1,5,9,12-tetrazatetracyclo[7.6.2.05,16.012,17]heptadecane is C1CN2CCCN3CCN4CCCN(C1)C2C34.
What is the InChIKey of 1,5,9,12-tetrazatetracyclo[7.6.2.05,16.012,17]heptadecane?
The InChIKey is NOWMAIXHVPVKJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N4/c1-4-14-6-2-8-16-10-11-17-9-3-7-15(5-1)12(14)13(16)17/h12-13H,1-11H2.
What are the key properties of 1,5,9,12-tetrazatetracyclo[7.6.2.05,16.012,17]heptadecane?
1,5,9,12-tetrazatetracyclo[7.6.2.05,16.012,17]heptadecane has a molecular weight of 236.36 g/mol, XLogP of 0.07, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5,9,12-tetrazatetracyclo[7.6.2.05,16.012,17]heptadecane is sourced from PubChem (CID 54122759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).