About 1,3,5,7-tetrazatetracyclo[5.2.1.03,9.05,8]decane
1,3,5,7-tetrazatetracyclo[5.2.1.03,9.05,8]decane (PubChem CID 20667383) has the molecular formula C6H10N4
and a molecular weight of 138.17 g/mol. Its IUPAC name is 1,3,5,7-tetrazatetracyclo[5.2.1.03,9.05,8]decane.
Analyze 1,3,5,7-tetrazatetracyclo[5.2.1.03,9.05,8]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,5,7-tetrazatetracyclo[5.2.1.03,9.05,8]decane?
The IUPAC name of 1,3,5,7-tetrazatetracyclo[5.2.1.03,9.05,8]decane (CID 20667383) is 1,3,5,7-tetrazatetracyclo[5.2.1.03,9.05,8]decane.
What is the SMILES notation for 1,3,5,7-tetrazatetracyclo[5.2.1.03,9.05,8]decane?
The canonical SMILES for 1,3,5,7-tetrazatetracyclo[5.2.1.03,9.05,8]decane is C1N2CN3CN4CN1C2C34.
What is the InChIKey of 1,3,5,7-tetrazatetracyclo[5.2.1.03,9.05,8]decane?
The InChIKey is NKQPKBONBXYYBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4/c1-7-3-9-2-10-4-8(1)5(7)6(9)10/h5-6H,1-4H2.
What are the key properties of 1,3,5,7-tetrazatetracyclo[5.2.1.03,9.05,8]decane?
1,3,5,7-tetrazatetracyclo[5.2.1.03,9.05,8]decane has a molecular weight of 138.17 g/mol, XLogP of -1.27, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,5,7-tetrazatetracyclo[5.2.1.03,9.05,8]decane is sourced from PubChem (CID 20667383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).