C13H24N4 — CID 101135242
(16R,17S)-1,5,9,12-tetrazatetracyclo[7.6.2.05,17.012,16]heptadecane (PubChem CID 101135242) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is (16R,17S)-1,5,9,12-tetrazatetracyclo[7.6.2.05,17.012,16]heptadecane.
| Compound Name | (16R,17S)-1,5,9,12-tetrazatetracyclo[7.6.2.05,17.012,16]heptadecane |
|---|---|
| PubChem CID | 101135242 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | (16R,17S)-1,5,9,12-tetrazatetracyclo[7.6.2.05,17.012,16]heptadecane |
| SMILES | C1CN2CCCN3CCN4CCCN(C1)[C@@H]4[C@H]23 |
| InChI | InChI=1S/C13H24N4/c1-4-14-6-2-8-16-10-11-17-9-3-7-15(5-1)13(17)12(14)16/h12-13H,1-11H2/t12-,13+ |
| InChIKey | ZAVOUJVICUCFTO-BETUJISGSA-N |
| XLogP | 0.07 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |