About (1S,2R)-3,7,10,14-tetrazatricyclo[8.4.0.02,7]tetradecane
(1S,2R)-3,7,10,14-tetrazatricyclo[8.4.0.02,7]tetradecane (PubChem CID 10867261) has the molecular formula C10H20N4
and a molecular weight of 196.30 g/mol. Its IUPAC name is (1S,2R)-3,7,10,14-tetrazatricyclo[8.4.0.02,7]tetradecane.
Analyze (1S,2R)-3,7,10,14-tetrazatricyclo[8.4.0.02,7]tetradecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2R)-3,7,10,14-tetrazatricyclo[8.4.0.02,7]tetradecane?
The IUPAC name of (1S,2R)-3,7,10,14-tetrazatricyclo[8.4.0.02,7]tetradecane (CID 10867261) is (1S,2R)-3,7,10,14-tetrazatricyclo[8.4.0.02,7]tetradecane.
What is the SMILES notation for (1S,2R)-3,7,10,14-tetrazatricyclo[8.4.0.02,7]tetradecane?
The canonical SMILES for (1S,2R)-3,7,10,14-tetrazatricyclo[8.4.0.02,7]tetradecane is C1CN[C@@H]2[C@@H]3NCCCN3CCN2C1.
What is the InChIKey of (1S,2R)-3,7,10,14-tetrazatricyclo[8.4.0.02,7]tetradecane?
The InChIKey is UFIHNLZICKCIRN-AOOOYVTPSA-N. The full InChI is InChI=1S/C10H20N4/c1-3-11-9-10-12-4-2-6-14(10)8-7-13(9)5-1/h9-12H,1-8H2/t9-,10+.
What are the key properties of (1S,2R)-3,7,10,14-tetrazatricyclo[8.4.0.02,7]tetradecane?
(1S,2R)-3,7,10,14-tetrazatricyclo[8.4.0.02,7]tetradecane has a molecular weight of 196.30 g/mol, XLogP of -0.76, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2R)-3,7,10,14-tetrazatricyclo[8.4.0.02,7]tetradecane is sourced from PubChem (CID 10867261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).