C9H18N4 — CID 58681478
3,7,9,13-tetrazatricyclo[7.4.0.02,7]tridecane (PubChem CID 58681478) has the molecular formula C9H18N4 and a molecular weight of 182.27 g/mol. Its IUPAC name is 3,7,9,13-tetrazatricyclo[7.4.0.02,7]tridecane.
| Compound Name | 3,7,9,13-tetrazatricyclo[7.4.0.02,7]tridecane |
|---|---|
| PubChem CID | 58681478 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 3,7,9,13-tetrazatricyclo[7.4.0.02,7]tridecane |
| SMILES | C1CNC2C3NCCCN3CN2C1 |
| InChI | InChI=1S/C9H18N4/c1-3-10-8-9-11-4-2-6-13(9)7-12(8)5-1/h8-11H,1-7H2 |
| InChIKey | BYCKYAZVOCRRSL-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |