C13H5Cl7 — CID 15191122
1,3-dichloro-5-(3,5-dichlorophenyl)-2-(trichloromethyl)benzene (PubChem CID 15191122) has the molecular formula C13H5Cl7 and a molecular weight of 409.35 g/mol. Its IUPAC name is 1,3-dichloro-5-(3,5-dichlorophenyl)-2-(trichloromethyl)benzene.
| Compound Name | 1,3-dichloro-5-(3,5-dichlorophenyl)-2-(trichloromethyl)benzene |
|---|---|
| PubChem CID | 15191122 |
| Molecular Formula | C13H5Cl7 |
| Molecular Weight | 409.35 g/mol |
| Exact Mass | 405.82 |
| IUPAC Name | 1,3-dichloro-5-(3,5-dichlorophenyl)-2-(trichloromethyl)benzene |
| SMILES | Clc1cc(Cl)cc(-c2cc(Cl)c(C(Cl)(Cl)Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C13H5Cl7/c14-8-1-6(2-9(15)5-8)7-3-10(16)12(11(17)4-7)13(18,19)20/h1-5H |
| InChIKey | FOQFYLYDKCOCRE-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.35 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|