C26H28N2O3 — CID 15195144
(1S,5S)-7-[(4R,5R)-4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl]-1,5,7-trimethyl-3-azabicyclo[3.3.1]nonane-2,4-dione (PubChem CID 15195144) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is (1S,5S)-7-[(4R,5R)-4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl]-1,5,7-trimethyl-3-azabicyclo[3.3.1]nonane-2,4-dione.
| Compound Name | (1S,5S)-7-[(4R,5R)-4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl]-1,5,7-trimethyl-3-azabicyclo[3.3.1]nonane-2,4-dione |
|---|---|
| PubChem CID | 15195144 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (1S,5S)-7-[(4R,5R)-4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl]-1,5,7-trimethyl-3-azabicyclo[3.3.1]nonane-2,4-dione |
| SMILES | CC1(C2=N[C@H](c3ccccc3)[C@@H](c3ccccc3)O2)C[C@@]2(C)C[C@](C)(C1)C(=O)NC2=O |
| InChI | InChI=1S/C26H28N2O3/c1-24-14-25(2,22(30)28-21(24)29)16-26(3,15-24)23-27-19(17-10-6-4-7-11-17)20(31-23)18-12-8-5-9-13-18/h4-13,19-20H,14-16H2,1-3H3,(H,28,29,30)/t19-,20-,24-,25-/m1/s1 |
| InChIKey | SEEGPLZJSGHXPR-GQUJEBGOSA-N |
| XLogP | 4.76 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|