C9H16N2O3S — CID 151955508
butyl N-[4-(hydroxymethyl)-4,5-dihydro-1,3-thiazol-2-yl]carbamate (PubChem CID 151955508) has the molecular formula C9H16N2O3S and a molecular weight of 232.30 g/mol. Its IUPAC name is butyl N-[4-(hydroxymethyl)-4,5-dihydro-1,3-thiazol-2-yl]carbamate.
| Compound Name | butyl N-[4-(hydroxymethyl)-4,5-dihydro-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 151955508 |
| Molecular Formula | C9H16N2O3S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | butyl N-[4-(hydroxymethyl)-4,5-dihydro-1,3-thiazol-2-yl]carbamate |
| SMILES | CCCCOC(=O)NC1=NC(CO)CS1 |
| InChI | InChI=1S/C9H16N2O3S/c1-2-3-4-14-9(13)11-8-10-7(5-12)6-15-8/h7,12H,2-6H2,1H3,(H,10,11,13) |
| InChIKey | TXNVAHLBCXEIGG-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|