C13H12N6O2S — CID 151983863
7-amino-4-(furan-2-yl)-10-propyl-12-thia-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-11-one (PubChem CID 151983863) has the molecular formula C13H12N6O2S and a molecular weight of 316.35 g/mol. Its IUPAC name is 7-amino-4-(furan-2-yl)-10-propyl-12-thia-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-11-one.
| Compound Name | 7-amino-4-(furan-2-yl)-10-propyl-12-thia-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-11-one |
|---|---|
| PubChem CID | 151983863 |
| Molecular Formula | C13H12N6O2S |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 7-amino-4-(furan-2-yl)-10-propyl-12-thia-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-11-one |
| SMILES | CCCn1c(=O)sc2c1nc(N)n1nc(-c3ccco3)nc21 |
| InChI | InChI=1S/C13H12N6O2S/c1-2-5-18-10-8(22-13(18)20)11-15-9(7-4-3-6-21-7)17-19(11)12(14)16-10/h3-4,6H,2,5H2,1H3,(H2,14,16) |
| InChIKey | UDGIWKIQFGZIED-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 104.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |