C11H8N2OS3 — CID 15216033
5,8,12-trithia-10,15-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10,13-tetraen-16-one (PubChem CID 15216033) has the molecular formula C11H8N2OS3 and a molecular weight of 280.40 g/mol. Its IUPAC name is 5,8,12-trithia-10,15-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10,13-tetraen-16-one.
| Compound Name | 5,8,12-trithia-10,15-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10,13-tetraen-16-one |
|---|---|
| PubChem CID | 15216033 |
| Molecular Formula | C11H8N2OS3 |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 279.98 |
| IUPAC Name | 5,8,12-trithia-10,15-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10,13-tetraen-16-one |
| SMILES | O=c1c2c3c(sc2nc2sccn12)CSCC3 |
| InChI | InChI=1S/C11H8N2OS3/c14-10-8-6-1-3-15-5-7(6)17-9(8)12-11-13(10)2-4-16-11/h2,4H,1,3,5H2 |
| InChIKey | LCEINOQAVNATFA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |