C19H11N5O6 — CID 15222894
8-[(4-nitrobenzoyl)amino]-10-oxopyridazino[6,1-b]quinazoline-2-carboxylic acid (PubChem CID 15222894) has the molecular formula C19H11N5O6 and a molecular weight of 405.33 g/mol. Its IUPAC name is 8-[(4-nitrobenzoyl)amino]-10-oxopyridazino[6,1-b]quinazoline-2-carboxylic acid.
| Compound Name | 8-[(4-nitrobenzoyl)amino]-10-oxopyridazino[6,1-b]quinazoline-2-carboxylic acid |
|---|---|
| PubChem CID | 15222894 |
| Molecular Formula | C19H11N5O6 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | 8-[(4-nitrobenzoyl)amino]-10-oxopyridazino[6,1-b]quinazoline-2-carboxylic acid |
| SMILES | O=C(Nc1ccc2nc3ccc(C(=O)O)nn3c(=O)c2c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H11N5O6/c25-17(10-1-4-12(5-2-10)24(29)30)20-11-3-6-14-13(9-11)18(26)23-16(21-14)8-7-15(22-23)19(27)28/h1-9H,(H,20,25)(H,27,28) |
| InChIKey | GFLWYOIHXLMGDF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 156.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|