2-[5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid

C7H4F6O5 — CID 15223780

IUPAC2-[5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid
SMILESO=C(O)CC1OC(C(F)(F)F)(C(F)(F)F)OC1=O
InChIInChI=1S/C7H4F6O5/c8-6(9,10)5(7(11,12)13)17-2(1-3(14)15)4(16)18-5/h2H,1H2,(H,14,15)
InChIKeyAKAMXKBFJWZRDT-UHFFFAOYSA-N
MW282.09 g/mol
LogP1.22
Rot. Bonds2

About 2-[5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid

2-[5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid (PubChem CID 15223780) has the molecular formula C7H4F6O5 and a molecular weight of 282.09 g/mol. Its IUPAC name is 2-[5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid.

Molecular Properties

Compound Name2-[5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid
PubChem CID15223780
Molecular FormulaC7H4F6O5
Molecular Weight282.09 g/mol
Exact Mass282.00
IUPAC Name2-[5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid
SMILESO=C(O)CC1OC(C(F)(F)F)(C(F)(F)F)OC1=O
InChIInChI=1S/C7H4F6O5/c8-6(9,10)5(7(11,12)13)17-2(1-3(14)15)4(16)18-5/h2H,1H2,(H,14,15)
InChIKeyAKAMXKBFJWZRDT-UHFFFAOYSA-N
XLogP1.22
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.09
LogP ≤ 51.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid?
The IUPAC name of 2-[5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid (CID 15223780) is 2-[5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid.
What is the SMILES notation for 2-[5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid?
The canonical SMILES for 2-[5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid is O=C(O)CC1OC(C(F)(F)F)(C(F)(F)F)OC1=O.
What is the InChIKey of 2-[5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid?
The InChIKey is AKAMXKBFJWZRDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4F6O5/c8-6(9,10)5(7(11,12)13)17-2(1-3(14)15)4(16)18-5/h2H,1H2,(H,14,15).
What are the key properties of 2-[5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid?
2-[5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid has a molecular weight of 282.09 g/mol, XLogP of 1.22, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid is sourced from PubChem (CID 15223780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).