C30H44O4 — CID 15240838
(1S,2S,4S,5R,6S,11R,14R,15S,18S,21R,22S,23R)-6,10,10,14,15,21,22-heptamethyl-3,24-dioxaheptacyclo[16.5.2.01,15.02,4.05,14.06,11.018,23]pentacosane-9,25-dione (PubChem CID 15240838) has the molecular formula C30H44O4 and a molecular weight of 468.68 g/mol. Its IUPAC name is (1S,2S,4S,5R,6S,11R,14R,15S,18S,21R,22S,23R)-6,10,10,14,15,21,22-heptamethyl-3,24-dioxaheptacyclo[16.5.2.01,15.02,4.05,14.06,11.018,23]pentacosane-9,25-dione.
| Compound Name | (1S,2S,4S,5R,6S,11R,14R,15S,18S,21R,22S,23R)-6,10,10,14,15,21,22-heptamethyl-3,24-dioxaheptacyclo[16.5.2.01,15.02,4.05,14.06,11.018,23]pentacosane-9,25-dione |
|---|---|
| PubChem CID | 15240838 |
| Molecular Formula | C30H44O4 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | (1S,2S,4S,5R,6S,11R,14R,15S,18S,21R,22S,23R)-6,10,10,14,15,21,22-heptamethyl-3,24-dioxaheptacyclo[16.5.2.01,15.02,4.05,14.06,11.018,23]pentacosane-9,25-dione |
| SMILES | C[C@H]1[C@H](C)CC[C@@]23CC[C@]4(C)[C@@](OC2=O)([C@H]13)[C@H]1O[C@H]1[C@@H]1[C@@]2(C)CCC(=O)C(C)(C)[C@@H]2CC[C@]14C |
| InChI | InChI=1S/C30H44O4/c1-16-8-13-29-15-14-28(7)27(6)12-9-18-25(3,4)19(31)10-11-26(18,5)22(27)20-23(33-20)30(28,34-24(29)32)21(29)17(16)2/h16-18,20-23H,8-15H2,1-7H3/t16-,17+,18+,20+,21-,22-,23+,26+,27-,28+,29+,30-/m1/s1 |
| InChIKey | WUUCZIQANDYQFO-GYSALMHOSA-N |
| XLogP | 5.96 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|