C40H42N6 — CID 15252103
N-cyclohexyl-4-(1,3-diphenyl-1,2,4-triazaspiro[4.5]dec-2-en-4-yl)-1,3-diphenylpyrazol-5-amine (PubChem CID 15252103) has the molecular formula C40H42N6 and a molecular weight of 606.82 g/mol. Its IUPAC name is N-cyclohexyl-4-(1,3-diphenyl-1,2,4-triazaspiro[4.5]dec-2-en-4-yl)-1,3-diphenylpyrazol-5-amine.
| Compound Name | N-cyclohexyl-4-(1,3-diphenyl-1,2,4-triazaspiro[4.5]dec-2-en-4-yl)-1,3-diphenylpyrazol-5-amine |
|---|---|
| PubChem CID | 15252103 |
| Molecular Formula | C40H42N6 |
| Molecular Weight | 606.82 g/mol |
| Exact Mass | 606.35 |
| IUPAC Name | N-cyclohexyl-4-(1,3-diphenyl-1,2,4-triazaspiro[4.5]dec-2-en-4-yl)-1,3-diphenylpyrazol-5-amine |
| SMILES | c1ccc(C2=NN(c3ccccc3)C3(CCCCC3)N2c2c(-c3ccccc3)nn(-c3ccccc3)c2NC2CCCCC2)cc1 |
| InChI | InChI=1S/C40H42N6/c1-7-19-31(20-8-1)36-37(39(41-33-23-11-3-12-24-33)45(42-36)34-25-13-4-14-26-34)44-38(32-21-9-2-10-22-32)43-46(35-27-15-5-16-28-35)40(44)29-17-6-18-30-40/h1-2,4-5,7-10,13-16,19-22,25-28,33,41H,3,6,11-12,17-18,23-24,29-30H2 |
| InChIKey | URXRJMGKMHTYKR-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 48.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.82 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |