C14H25F3N2O2Si — CID 152528043
2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-6-(trifluoromethyl)-1H-pyridin-2-amine (PubChem CID 152528043) has the molecular formula C14H25F3N2O2Si and a molecular weight of 338.45 g/mol. Its IUPAC name is 2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-6-(trifluoromethyl)-1H-pyridin-2-amine.
| Compound Name | 2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-6-(trifluoromethyl)-1H-pyridin-2-amine |
|---|---|
| PubChem CID | 152528043 |
| Molecular Formula | C14H25F3N2O2Si |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-6-(trifluoromethyl)-1H-pyridin-2-amine |
| SMILES | CC(C)(C)[Si](C)(C)OCCOC1(N)C=CC=C(C(F)(F)F)N1 |
| InChI | InChI=1S/C14H25F3N2O2Si/c1-12(2,3)22(4,5)21-10-9-20-13(18)8-6-7-11(19-13)14(15,16)17/h6-8,19H,9-10,18H2,1-5H3 |
| InChIKey | YIYFIZOAQRVPAN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|