C13H23ClN2O4Si — CID 175965080
tert-butyl-[2-[(2-chloro-3-nitro-1H-pyridin-2-yl)oxy]ethoxy]-dimethylsilane (PubChem CID 175965080) has the molecular formula C13H23ClN2O4Si and a molecular weight of 334.88 g/mol. Its IUPAC name is tert-butyl-[2-[(2-chloro-3-nitro-1H-pyridin-2-yl)oxy]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[(2-chloro-3-nitro-1H-pyridin-2-yl)oxy]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 175965080 |
| Molecular Formula | C13H23ClN2O4Si |
| Molecular Weight | 334.88 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | tert-butyl-[2-[(2-chloro-3-nitro-1H-pyridin-2-yl)oxy]ethoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCOC1(Cl)NC=CC=C1[N+](=O)[O-] |
| InChI | InChI=1S/C13H23ClN2O4Si/c1-12(2,3)21(4,5)20-10-9-19-13(14)11(16(17)18)7-6-8-15-13/h6-8,15H,9-10H2,1-5H3 |
| InChIKey | FYJDLVRSMIWQEG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.88 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|