C16H32N2O2Si — CID 175965064
2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-propan-2-yl-1H-pyridin-3-amine (PubChem CID 175965064) has the molecular formula C16H32N2O2Si and a molecular weight of 312.53 g/mol. Its IUPAC name is 2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-propan-2-yl-1H-pyridin-3-amine.
| Compound Name | 2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-propan-2-yl-1H-pyridin-3-amine |
|---|---|
| PubChem CID | 175965064 |
| Molecular Formula | C16H32N2O2Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | 2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-propan-2-yl-1H-pyridin-3-amine |
| SMILES | CC(C)C1(OCCO[Si](C)(C)C(C)(C)C)NC=CC=C1N |
| InChI | InChI=1S/C16H32N2O2Si/c1-13(2)16(14(17)9-8-10-18-16)19-11-12-20-21(6,7)15(3,4)5/h8-10,13,18H,11-12,17H2,1-7H3 |
| InChIKey | WSIZMLKZIPMPHQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|