C14H19Cl2N3O2S — CID 152529683
9-(3,4-dichlorophenyl)sulfonyl-1,4,9-triazaspiro[5.5]undecane (PubChem CID 152529683) has the molecular formula C14H19Cl2N3O2S and a molecular weight of 364.30 g/mol. Its IUPAC name is 9-(3,4-dichlorophenyl)sulfonyl-1,4,9-triazaspiro[5.5]undecane.
| Compound Name | 9-(3,4-dichlorophenyl)sulfonyl-1,4,9-triazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 152529683 |
| Molecular Formula | C14H19Cl2N3O2S |
| Molecular Weight | 364.30 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 9-(3,4-dichlorophenyl)sulfonyl-1,4,9-triazaspiro[5.5]undecane |
| SMILES | O=S(=O)(c1ccc(Cl)c(Cl)c1)N1CCC2(CC1)CNCCN2 |
| InChI | InChI=1S/C14H19Cl2N3O2S/c15-12-2-1-11(9-13(12)16)22(20,21)19-7-3-14(4-8-19)10-17-5-6-18-14/h1-2,9,17-18H,3-8,10H2 |
| InChIKey | YJGSEUKYWWEAHP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |