C23H34F5NO3S — CID 152544454
N-[9-(3,4-dihydro-2H-chromen-2-yl)nonyl]-4,4,5,5,5-pentafluoropentane-1-sulfonamide (PubChem CID 152544454) has the molecular formula C23H34F5NO3S and a molecular weight of 499.59 g/mol. Its IUPAC name is N-[9-(3,4-dihydro-2H-chromen-2-yl)nonyl]-4,4,5,5,5-pentafluoropentane-1-sulfonamide.
| Compound Name | N-[9-(3,4-dihydro-2H-chromen-2-yl)nonyl]-4,4,5,5,5-pentafluoropentane-1-sulfonamide |
|---|---|
| PubChem CID | 152544454 |
| Molecular Formula | C23H34F5NO3S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | N-[9-(3,4-dihydro-2H-chromen-2-yl)nonyl]-4,4,5,5,5-pentafluoropentane-1-sulfonamide |
| SMILES | O=S(=O)(CCCC(F)(F)C(F)(F)F)NCCCCCCCCCC1CCc2ccccc2O1 |
| InChI | InChI=1S/C23H34F5NO3S/c24-22(25,23(26,27)28)16-10-18-33(30,31)29-17-9-5-3-1-2-4-6-12-20-15-14-19-11-7-8-13-21(19)32-20/h7-8,11,13,20,29H,1-6,9-10,12,14-18H2 |
| InChIKey | YMEOANOSAAQLLN-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|