C5H12Cl2N2 — CID 152547455
1,1-dichloropentane-2,4-diamine (PubChem CID 152547455) has the molecular formula C5H12Cl2N2 and a molecular weight of 171.07 g/mol. Its IUPAC name is 1,1-dichloropentane-2,4-diamine.
| Compound Name | 1,1-dichloropentane-2,4-diamine |
|---|---|
| PubChem CID | 152547455 |
| Molecular Formula | C5H12Cl2N2 |
| Molecular Weight | 171.07 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | 1,1-dichloropentane-2,4-diamine |
| SMILES | CC(N)CC(N)C(Cl)Cl |
| InChI | InChI=1S/C5H12Cl2N2/c1-3(8)2-4(9)5(6)7/h3-5H,2,8-9H2,1H3 |
| InChIKey | YMTXIBHBQYECHV-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.07 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|