About 4,5-dideuteriophenanthrene
4,5-dideuteriophenanthrene (PubChem CID 152551640) has the molecular formula C14H10
and a molecular weight of 180.25 g/mol. Its IUPAC name is 4,5-dideuteriophenanthrene.
Molecular Properties
| Compound Name | 4,5-dideuteriophenanthrene |
| PubChem CID | 152551640 |
| Molecular Formula | C14H10 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 4,5-dideuteriophenanthrene |
| SMILES | [2H]c1cccc2ccc3cccc([2H])c3c12 |
| InChI | InChI=1S/C14H10/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13/h1-10H/i7D,8D |
| InChIKey | YNPNZTXNASCQKK-QTQOOCSTSA-N |
| XLogP | 3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dideuteriophenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dideuteriophenanthrene?
The IUPAC name of 4,5-dideuteriophenanthrene (CID 152551640) is 4,5-dideuteriophenanthrene.
What is the SMILES notation for 4,5-dideuteriophenanthrene?
The canonical SMILES for 4,5-dideuteriophenanthrene is [2H]c1cccc2ccc3cccc([2H])c3c12.
What is the InChIKey of 4,5-dideuteriophenanthrene?
The InChIKey is YNPNZTXNASCQKK-QTQOOCSTSA-N. The full InChI is InChI=1S/C14H10/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13/h1-10H/i7D,8D.
What are the key properties of 4,5-dideuteriophenanthrene?
4,5-dideuteriophenanthrene has a molecular weight of 180.25 g/mol, XLogP of 3.99, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dideuteriophenanthrene is sourced from PubChem (CID 152551640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).