C27H29N3O4 — CID 152591721
2-[3-tert-butyl-4-hydroxy-5-(5-methylbenzo[e]benzotriazol-2-yl)phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 152591721) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is 2-[3-tert-butyl-4-hydroxy-5-(5-methylbenzo[e]benzotriazol-2-yl)phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[3-tert-butyl-4-hydroxy-5-(5-methylbenzo[e]benzotriazol-2-yl)phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 152591721 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 2-[3-tert-butyl-4-hydroxy-5-(5-methylbenzo[e]benzotriazol-2-yl)phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1cc(-n2nc3cc(C)c4ccccc4c3n2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C27H29N3O4/c1-16(2)26(32)34-12-11-33-18-14-21(27(4,5)6)25(31)23(15-18)30-28-22-13-17(3)19-9-7-8-10-20(19)24(22)29-30/h7-10,13-15,31H,1,11-12H2,2-6H3 |
| InChIKey | YVPUVRVJSXHVDJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|