C23H26ClN3O4 — CID 136660267
3-[3-tert-butyl-5-(5-chloro-2H-benzotriazol-4-yl)-4-hydroxyphenoxy]propyl 2-methylprop-2-enoate (PubChem CID 136660267) has the molecular formula C23H26ClN3O4 and a molecular weight of 443.93 g/mol. Its IUPAC name is 3-[3-tert-butyl-5-(5-chloro-2H-benzotriazol-4-yl)-4-hydroxyphenoxy]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[3-tert-butyl-5-(5-chloro-2H-benzotriazol-4-yl)-4-hydroxyphenoxy]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 136660267 |
| Molecular Formula | C23H26ClN3O4 |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 3-[3-tert-butyl-5-(5-chloro-2H-benzotriazol-4-yl)-4-hydroxyphenoxy]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCOc1cc(-c2c(Cl)ccc3n[nH]nc23)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H26ClN3O4/c1-13(2)22(29)31-10-6-9-30-14-11-15(21(28)16(12-14)23(3,4)5)19-17(24)7-8-18-20(19)26-27-25-18/h7-8,11-12,28H,1,6,9-10H2,2-5H3,(H,25,26,27) |
| InChIKey | QRHAIWVPSPKCPA-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|