About prop-2-ynyl 2-[2-(oxo-λ5-phosphanylidyne)ethoxy]acetate
prop-2-ynyl 2-[2-(oxo-λ5-phosphanylidyne)ethoxy]acetate (PubChem CID 152628809) has the molecular formula C7H7O4P
and a molecular weight of 186.10 g/mol. Its IUPAC name is prop-2-ynyl 2-[2-(oxo-λ5-phosphanylidyne)ethoxy]acetate.
Molecular Properties
| Compound Name | prop-2-ynyl 2-[2-(oxo-λ5-phosphanylidyne)ethoxy]acetate |
| PubChem CID | 152628809 |
| Molecular Formula | C7H7O4P |
| Molecular Weight | 186.10 g/mol |
| Exact Mass | 186.01 |
| IUPAC Name | prop-2-ynyl 2-[2-(oxo-λ5-phosphanylidyne)ethoxy]acetate |
| SMILES | C#CCOC(=O)COCC#P=O |
| InChI | InChI=1S/C7H7O4P/c1-2-3-11-7(8)6-10-4-5-12-9/h1H,3-4,6H2 |
| InChIKey | ZDBSMZVWRMYCSK-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.10 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-2-ynyl 2-[2-(oxo-λ5-phosphanylidyne)ethoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-ynyl 2-[2-(oxo-λ5-phosphanylidyne)ethoxy]acetate?
The IUPAC name of prop-2-ynyl 2-[2-(oxo-λ5-phosphanylidyne)ethoxy]acetate (CID 152628809) is prop-2-ynyl 2-[2-(oxo-λ5-phosphanylidyne)ethoxy]acetate.
What is the SMILES notation for prop-2-ynyl 2-[2-(oxo-λ5-phosphanylidyne)ethoxy]acetate?
The canonical SMILES for prop-2-ynyl 2-[2-(oxo-λ5-phosphanylidyne)ethoxy]acetate is C#CCOC(=O)COCC#P=O.
What is the InChIKey of prop-2-ynyl 2-[2-(oxo-λ5-phosphanylidyne)ethoxy]acetate?
The InChIKey is ZDBSMZVWRMYCSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7O4P/c1-2-3-11-7(8)6-10-4-5-12-9/h1H,3-4,6H2.
What are the key properties of prop-2-ynyl 2-[2-(oxo-λ5-phosphanylidyne)ethoxy]acetate?
prop-2-ynyl 2-[2-(oxo-λ5-phosphanylidyne)ethoxy]acetate has a molecular weight of 186.10 g/mol, XLogP of 0.43, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-ynyl 2-[2-(oxo-λ5-phosphanylidyne)ethoxy]acetate is sourced from PubChem (CID 152628809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).