C15H12N4O — CID 152649173
1,8,11-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-2,4,6,9,12,14,16-heptaene-6-carboxamide (PubChem CID 152649173) has the molecular formula C15H12N4O and a molecular weight of 264.29 g/mol. Its IUPAC name is 1,8,11-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-2,4,6,9,12,14,16-heptaene-6-carboxamide.
| Compound Name | 1,8,11-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-2,4,6,9,12,14,16-heptaene-6-carboxamide |
|---|---|
| PubChem CID | 152649173 |
| Molecular Formula | C15H12N4O |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 1,8,11-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-2,4,6,9,12,14,16-heptaene-6-carboxamide |
| SMILES | NC(=O)C1=CN2C=C3N(C=C2C=C1)C=C1C=CC=CN13 |
| InChI | InChI=1S/C15H12N4O/c16-15(20)11-4-5-12-8-18-9-13-3-1-2-6-19(13)14(18)10-17(12)7-11/h1-10H,(H2,16,20) |
| InChIKey | ZHEQZIXGBKYWMY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |