About [butoxy(ethoxy)boranyl] 2-methylprop-2-enoate
[butoxy(ethoxy)boranyl] 2-methylprop-2-enoate (PubChem CID 152671881) has the molecular formula C10H19BO4
and a molecular weight of 214.07 g/mol. Its IUPAC name is [butoxy(ethoxy)boranyl] 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | [butoxy(ethoxy)boranyl] 2-methylprop-2-enoate |
| PubChem CID | 152671881 |
| Molecular Formula | C10H19BO4 |
| Molecular Weight | 214.07 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | [butoxy(ethoxy)boranyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OB(OCC)OCCCC |
| InChI | InChI=1S/C10H19BO4/c1-5-7-8-14-11(13-6-2)15-10(12)9(3)4/h3,5-8H2,1-2,4H3 |
| InChIKey | ZLSGSQAPZWUJDV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.07 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [butoxy(ethoxy)boranyl] 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [butoxy(ethoxy)boranyl] 2-methylprop-2-enoate?
The IUPAC name of [butoxy(ethoxy)boranyl] 2-methylprop-2-enoate (CID 152671881) is [butoxy(ethoxy)boranyl] 2-methylprop-2-enoate.
What is the SMILES notation for [butoxy(ethoxy)boranyl] 2-methylprop-2-enoate?
The canonical SMILES for [butoxy(ethoxy)boranyl] 2-methylprop-2-enoate is C=C(C)C(=O)OB(OCC)OCCCC.
What is the InChIKey of [butoxy(ethoxy)boranyl] 2-methylprop-2-enoate?
The InChIKey is ZLSGSQAPZWUJDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19BO4/c1-5-7-8-14-11(13-6-2)15-10(12)9(3)4/h3,5-8H2,1-2,4H3.
What are the key properties of [butoxy(ethoxy)boranyl] 2-methylprop-2-enoate?
[butoxy(ethoxy)boranyl] 2-methylprop-2-enoate has a molecular weight of 214.07 g/mol, XLogP of 1.94, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [butoxy(ethoxy)boranyl] 2-methylprop-2-enoate is sourced from PubChem (CID 152671881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).