C15H16N2O3 — CID 15272839
5,6-dimethyl-3a-nitro-3-phenyl-7,7a-dihydro-4H-1,2-benzoxazole (PubChem CID 15272839) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is 5,6-dimethyl-3a-nitro-3-phenyl-7,7a-dihydro-4H-1,2-benzoxazole.
| Compound Name | 5,6-dimethyl-3a-nitro-3-phenyl-7,7a-dihydro-4H-1,2-benzoxazole |
|---|---|
| PubChem CID | 15272839 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 5,6-dimethyl-3a-nitro-3-phenyl-7,7a-dihydro-4H-1,2-benzoxazole |
| SMILES | CC1=C(C)CC2([N+](=O)[O-])C(c3ccccc3)=NOC2C1 |
| InChI | InChI=1S/C15H16N2O3/c1-10-8-13-15(17(18)19,9-11(10)2)14(16-20-13)12-6-4-3-5-7-12/h3-7,13H,8-9H2,1-2H3 |
| InChIKey | NKGJGJQJBSTMKM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|