C14H13ClN4O5S — CID 152740406
3-amino-2-(4-chloro-3-sulfamoylbenzoyl)-4-hydrazinylbenzoic acid (PubChem CID 152740406) has the molecular formula C14H13ClN4O5S and a molecular weight of 384.80 g/mol. Its IUPAC name is 3-amino-2-(4-chloro-3-sulfamoylbenzoyl)-4-hydrazinylbenzoic acid.
| Compound Name | 3-amino-2-(4-chloro-3-sulfamoylbenzoyl)-4-hydrazinylbenzoic acid |
|---|---|
| PubChem CID | 152740406 |
| Molecular Formula | C14H13ClN4O5S |
| Molecular Weight | 384.80 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | 3-amino-2-(4-chloro-3-sulfamoylbenzoyl)-4-hydrazinylbenzoic acid |
| SMILES | NNc1ccc(C(=O)O)c(C(=O)c2ccc(Cl)c(S(N)(=O)=O)c2)c1N |
| InChI | InChI=1S/C14H13ClN4O5S/c15-8-3-1-6(5-10(8)25(18,23)24)13(20)11-7(14(21)22)2-4-9(19-17)12(11)16/h1-5,19H,16-17H2,(H,21,22)(H2,18,23,24) |
| InChIKey | ZZMONXONVBBWQE-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 178.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.80 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|