C38H31BrCl2N4O6S2 — CID 158520289
aniline;5-(4-anilinobenzoyl)-2-chlorobenzenesulfonamide;5-(4-bromobenzoyl)-2-chlorobenzenesulfonamide (PubChem CID 158520289) has the molecular formula C38H31BrCl2N4O6S2 and a molecular weight of 854.63 g/mol. Its IUPAC name is aniline;5-(4-anilinobenzoyl)-2-chlorobenzenesulfonamide;5-(4-bromobenzoyl)-2-chlorobenzenesulfonamide.
| Compound Name | aniline;5-(4-anilinobenzoyl)-2-chlorobenzenesulfonamide;5-(4-bromobenzoyl)-2-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 158520289 |
| Molecular Formula | C38H31BrCl2N4O6S2 |
| Molecular Weight | 854.63 g/mol |
| Exact Mass | 852.02 |
| IUPAC Name | aniline;5-(4-anilinobenzoyl)-2-chlorobenzenesulfonamide;5-(4-bromobenzoyl)-2-chlorobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(C(=O)c2ccc(Br)cc2)ccc1Cl.NS(=O)(=O)c1cc(C(=O)c2ccc(Nc3ccccc3)cc2)ccc1Cl.Nc1ccccc1 |
| InChI | InChI=1S/C19H15ClN2O3S.C13H9BrClNO3S.C6H7N/c20-17-11-8-14(12-18(17)26(21,24)25)19(23)13-6-9-16(10-7-13)22-15-4-2-1-3-5-15;14-10-4-1-8(2-5-10)13(17)9-3-6-11(15)12(7-9)20(16,18)19;7-6-4-2-1-3-5-6/h1-12,22H,(H2,21,24,25);1-7H,(H2,16,18,19);1-5H,7H2 |
| InChIKey | HMDCXIRSSCBBRM-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 192.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.63 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|