C7H5F6O2- — CID 152743604
5,5,5-trifluoro-2-methyl-4-(trifluoromethyl)pent-2-enoate (PubChem CID 152743604) has the molecular formula C7H5F6O2- and a molecular weight of 235.10 g/mol. Its IUPAC name is 5,5,5-trifluoro-2-methyl-4-(trifluoromethyl)pent-2-enoate.
| Compound Name | 5,5,5-trifluoro-2-methyl-4-(trifluoromethyl)pent-2-enoate |
|---|---|
| PubChem CID | 152743604 |
| Molecular Formula | C7H5F6O2- |
| Molecular Weight | 235.10 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | 5,5,5-trifluoro-2-methyl-4-(trifluoromethyl)pent-2-enoate |
| SMILES | CC(=CC(C(F)(F)F)C(F)(F)F)C(=O)[O-] |
| InChI | InChI=1S/C7H6F6O2/c1-3(5(14)15)2-4(6(8,9)10)7(11,12)13/h2,4H,1H3,(H,14,15)/p-1 |
| InChIKey | HHPAOJUQDMPRFO-UHFFFAOYSA-M |
| XLogP | 1.42 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.10 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|