C18H12Cl2F3NO2 — CID 152744903
1-(2,4-dichloro-5-fluorophenyl)-2-[(2,4-difluorophenyl)iminomethyl]-1-hydroxypent-1-en-3-one (PubChem CID 152744903) has the molecular formula C18H12Cl2F3NO2 and a molecular weight of 402.20 g/mol. Its IUPAC name is 1-(2,4-dichloro-5-fluorophenyl)-2-[(2,4-difluorophenyl)iminomethyl]-1-hydroxypent-1-en-3-one.
| Compound Name | 1-(2,4-dichloro-5-fluorophenyl)-2-[(2,4-difluorophenyl)iminomethyl]-1-hydroxypent-1-en-3-one |
|---|---|
| PubChem CID | 152744903 |
| Molecular Formula | C18H12Cl2F3NO2 |
| Molecular Weight | 402.20 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 1-(2,4-dichloro-5-fluorophenyl)-2-[(2,4-difluorophenyl)iminomethyl]-1-hydroxypent-1-en-3-one |
| SMILES | CCC(=O)C(/C=N/c1ccc(F)cc1F)=C(O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H12Cl2F3NO2/c1-2-17(25)11(8-24-16-4-3-9(21)5-15(16)23)18(26)10-6-14(22)13(20)7-12(10)19/h3-8,26H,2H2,1H3/b18-11?,24-8+ |
| InChIKey | MKXZPNSVJQHCDX-YFKREWPISA-N |
| XLogP | 6.06 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.20 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|