C37H75NO7P+ — CID 152750030
3,3-dihydroxypropyl-[1-[[(2R)-3-[(6Z,18Z)-hexacosa-6,18-dienoxy]-2-hydroxypropoxy]-hydroxyphosphoryl]propyl]-dimethylazanium (PubChem CID 152750030) has the molecular formula C37H75NO7P+ and a molecular weight of 676.98 g/mol. Its IUPAC name is 3,3-dihydroxypropyl-[1-[[(2R)-3-[(6Z,18Z)-hexacosa-6,18-dienoxy]-2-hydroxypropoxy]-hydroxyphosphoryl]propyl]-dimethylazanium.
| Compound Name | 3,3-dihydroxypropyl-[1-[[(2R)-3-[(6Z,18Z)-hexacosa-6,18-dienoxy]-2-hydroxypropoxy]-hydroxyphosphoryl]propyl]-dimethylazanium |
|---|---|
| PubChem CID | 152750030 |
| Molecular Formula | C37H75NO7P+ |
| Molecular Weight | 676.98 g/mol |
| Exact Mass | 676.53 |
| IUPAC Name | 3,3-dihydroxypropyl-[1-[[(2R)-3-[(6Z,18Z)-hexacosa-6,18-dienoxy]-2-hydroxypropoxy]-hydroxyphosphoryl]propyl]-dimethylazanium |
| SMILES | CCCCCCC/C=C\CCCCCCCCCC/C=C\CCCCCOC[C@@H](O)COP(=O)(O)C(CC)[N+](C)(C)CCC(O)O |
| InChI | InChI=1S/C37H74NO7P/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-29-32-44-33-35(39)34-45-46(42,43)36(6-2)38(3,4)31-30-37(40)41/h12-13,24-25,35-37,39-41H,5-11,14-23,26-34H2,1-4H3/p+1/b13-12-,25-24-/t35-,36?/m1/s1 |
| InChIKey | DJWDEERRTNRGCV-BIYPIJKCSA-O |
| XLogP | 9.01 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.98 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|